C24H21ClN2O8S — CID 126169557
methyl 5-[[2-[(5E)-5-[(4-acetyloxy-3-ethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate (PubChem CID 126169557) has the molecular formula C24H21ClN2O8S and a molecular weight of 532.96 g/mol. Its IUPAC name is methyl 5-[[2-[(5E)-5-[(4-acetyloxy-3-ethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate.
| Compound Name | methyl 5-[[2-[(5E)-5-[(4-acetyloxy-3-ethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 126169557 |
| Molecular Formula | C24H21ClN2O8S |
| Molecular Weight | 532.96 g/mol |
| Exact Mass | 532.07 |
| IUPAC Name | methyl 5-[[2-[(5E)-5-[(4-acetyloxy-3-ethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccc(Cl)c(C(=O)OC)c3)C2=O)ccc1OC(C)=O |
| InChI | InChI=1S/C24H21ClN2O8S/c1-4-34-19-9-14(5-8-18(19)35-13(2)28)10-20-22(30)27(24(32)36-20)12-21(29)26-15-6-7-17(25)16(11-15)23(31)33-3/h5-11H,4,12H2,1-3H3,(H,26,29)/b20-10+ |
| InChIKey | OSCHOTLTXSJYDV-KEBDBYFISA-N |
| XLogP | 4.13 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.96 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|