C25H22ClN3O7S — CID 126160431
ethyl 2-chloro-5-[[2-[(5Z)-5-[[4-(cyanomethoxy)-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126160431) has the molecular formula C25H22ClN3O7S and a molecular weight of 543.99 g/mol. Its IUPAC name is ethyl 2-chloro-5-[[2-[(5Z)-5-[[4-(cyanomethoxy)-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-5-[[2-[(5Z)-5-[[4-(cyanomethoxy)-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126160431 |
| Molecular Formula | C25H22ClN3O7S |
| Molecular Weight | 543.99 g/mol |
| Exact Mass | 543.09 |
| IUPAC Name | ethyl 2-chloro-5-[[2-[(5Z)-5-[[4-(cyanomethoxy)-3-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C\c3ccc(OCC#N)c(OCC)c3)C2=O)ccc1Cl |
| InChI | InChI=1S/C25H22ClN3O7S/c1-3-34-20-11-15(5-8-19(20)36-10-9-27)12-21-23(31)29(25(33)37-21)14-22(30)28-16-6-7-18(26)17(13-16)24(32)35-4-2/h5-8,11-13H,3-4,10,14H2,1-2H3,(H,28,30)/b21-12- |
| InChIKey | MVYVGTVXUMMIIT-MTJSOVHGSA-N |
| XLogP | 4.49 |
| TPSA | 135.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.99 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|