C28H30ClIN2O7S — CID 126179062
butyl 2-chloro-5-[[2-[(5Z)-5-[(3-ethoxy-5-iodo-4-propoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126179062) has the molecular formula C28H30ClIN2O7S and a molecular weight of 700.98 g/mol. Its IUPAC name is butyl 2-chloro-5-[[2-[(5Z)-5-[(3-ethoxy-5-iodo-4-propoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | butyl 2-chloro-5-[[2-[(5Z)-5-[(3-ethoxy-5-iodo-4-propoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126179062 |
| Molecular Formula | C28H30ClIN2O7S |
| Molecular Weight | 700.98 g/mol |
| Exact Mass | 700.05 |
| IUPAC Name | butyl 2-chloro-5-[[2-[(5Z)-5-[(3-ethoxy-5-iodo-4-propoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C\c3cc(I)c(OCCC)c(OCC)c3)C2=O)ccc1Cl |
| InChI | InChI=1S/C28H30ClIN2O7S/c1-4-7-11-39-27(35)19-15-18(8-9-20(19)29)31-24(33)16-32-26(34)23(40-28(32)36)14-17-12-21(30)25(38-10-5-2)22(13-17)37-6-3/h8-9,12-15H,4-7,10-11,16H2,1-3H3,(H,31,33)/b23-14- |
| InChIKey | FNNLHCRNZHSNHJ-UCQKPKSFSA-N |
| XLogP | 6.76 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.98 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|