C28H20Br2Cl2N2O6S — CID 126160859
ethyl 2-chloro-5-[[2-[(5E)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126160859) has the molecular formula C28H20Br2Cl2N2O6S and a molecular weight of 743.26 g/mol. Its IUPAC name is ethyl 2-chloro-5-[[2-[(5E)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-5-[[2-[(5E)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126160859 |
| Molecular Formula | C28H20Br2Cl2N2O6S |
| Molecular Weight | 743.26 g/mol |
| Exact Mass | 739.88 |
| IUPAC Name | ethyl 2-chloro-5-[[2-[(5E)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3cc(Br)c(OCc4ccccc4Cl)c(Br)c3)C2=O)ccc1Cl |
| InChI | InChI=1S/C28H20Br2Cl2N2O6S/c1-2-39-27(37)18-12-17(7-8-22(18)32)33-24(35)13-34-26(36)23(41-28(34)38)11-15-9-19(29)25(20(30)10-15)40-14-16-5-3-4-6-21(16)31/h3-12H,2,13-14H2,1H3,(H,33,35)/b23-11+ |
| InChIKey | PBKIRRJXNVVUDY-FOKLQQMPSA-N |
| XLogP | 7.95 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.26 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|