C27H20Br2Cl2N2O4S — CID 126188728
2-[(5E)-5-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethylphenyl)acetamide (PubChem CID 126188728) has the molecular formula C27H20Br2Cl2N2O4S and a molecular weight of 699.25 g/mol. Its IUPAC name is 2-[(5E)-5-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 126188728 |
| Molecular Formula | C27H20Br2Cl2N2O4S |
| Molecular Weight | 699.25 g/mol |
| Exact Mass | 695.89 |
| IUPAC Name | 2-[(5E)-5-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)CN2C(=O)S/C(=C/c3cc(Br)c(OCc4ccc(Cl)cc4Cl)c(Br)c3)C2=O)cc1 |
| InChI | InChI=1S/C27H20Br2Cl2N2O4S/c1-2-15-3-7-19(8-4-15)32-24(34)13-33-26(35)23(38-27(33)36)11-16-9-20(28)25(21(29)10-16)37-14-17-5-6-18(30)12-22(17)31/h3-12H,2,13-14H2,1H3,(H,32,34)/b23-11+ |
| InChIKey | LHVMSUXUQSWXOL-FOKLQQMPSA-N |
| XLogP | 8.33 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.25 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|