C30H26Cl2N2O6S — CID 126176140
butyl 2-chloro-5-[[2-[(5E)-5-[[2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126176140) has the molecular formula C30H26Cl2N2O6S and a molecular weight of 613.52 g/mol. Its IUPAC name is butyl 2-chloro-5-[[2-[(5E)-5-[[2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | butyl 2-chloro-5-[[2-[(5E)-5-[[2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126176140 |
| Molecular Formula | C30H26Cl2N2O6S |
| Molecular Weight | 613.52 g/mol |
| Exact Mass | 612.09 |
| IUPAC Name | butyl 2-chloro-5-[[2-[(5E)-5-[[2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3ccccc3OCc3ccccc3Cl)C2=O)ccc1Cl |
| InChI | InChI=1S/C30H26Cl2N2O6S/c1-2-3-14-39-29(37)22-16-21(12-13-24(22)32)33-27(35)17-34-28(36)26(41-30(34)38)15-19-8-5-7-11-25(19)40-18-20-9-4-6-10-23(20)31/h4-13,15-16H,2-3,14,17-18H2,1H3,(H,33,35)/b26-15+ |
| InChIKey | RKULOSYSLJLXPZ-CVKSISIWSA-N |
| XLogP | 7.20 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.52 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|