C32H28ClN3O5S — CID 126272921
propyl 5-[[2-[(5Z)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate (PubChem CID 126272921) has the molecular formula C32H28ClN3O5S and a molecular weight of 602.11 g/mol. Its IUPAC name is propyl 5-[[2-[(5Z)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate.
| Compound Name | propyl 5-[[2-[(5Z)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 126272921 |
| Molecular Formula | C32H28ClN3O5S |
| Molecular Weight | 602.11 g/mol |
| Exact Mass | 601.14 |
| IUPAC Name | propyl 5-[[2-[(5Z)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]-2-chlorobenzoate |
| SMILES | CCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C\c3c(C)n(Cc4ccccc4)c4ccccc34)C2=O)ccc1Cl |
| InChI | InChI=1S/C32H28ClN3O5S/c1-3-15-41-31(39)25-16-22(13-14-26(25)33)34-29(37)19-36-30(38)28(42-32(36)40)17-24-20(2)35(18-21-9-5-4-6-10-21)27-12-8-7-11-23(24)27/h4-14,16-17H,3,15,18-19H2,1-2H3,(H,34,37)/b28-17- |
| InChIKey | RGAREOLEUIPUTP-QRQIAZFYSA-N |
| XLogP | 6.89 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.11 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|