C31H24Cl3N3O5S — CID 126175875
propyl 2-chloro-5-[[2-[(5E)-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126175875) has the molecular formula C31H24Cl3N3O5S and a molecular weight of 656.98 g/mol. Its IUPAC name is propyl 2-chloro-5-[[2-[(5E)-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | propyl 2-chloro-5-[[2-[(5E)-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126175875 |
| Molecular Formula | C31H24Cl3N3O5S |
| Molecular Weight | 656.98 g/mol |
| Exact Mass | 655.05 |
| IUPAC Name | propyl 2-chloro-5-[[2-[(5E)-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3cn(Cc4ccc(Cl)cc4Cl)c4ccccc34)C2=O)ccc1Cl |
| InChI | InChI=1S/C31H24Cl3N3O5S/c1-2-11-42-30(40)23-14-21(9-10-24(23)33)35-28(38)17-37-29(39)27(43-31(37)41)12-19-16-36(26-6-4-3-5-22(19)26)15-18-7-8-20(32)13-25(18)34/h3-10,12-14,16H,2,11,15,17H2,1H3,(H,35,38)/b27-12+ |
| InChIKey | QDHQIFCOHTVCEA-KKMKTNMSSA-N |
| XLogP | 7.89 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.98 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|