C30H22Cl2FN3O5S — CID 126269893
ethyl 2-chloro-5-[[2-[(5Z)-5-[[1-[(2-chloro-4-fluorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126269893) has the molecular formula C30H22Cl2FN3O5S and a molecular weight of 626.49 g/mol. Its IUPAC name is ethyl 2-chloro-5-[[2-[(5Z)-5-[[1-[(2-chloro-4-fluorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-5-[[2-[(5Z)-5-[[1-[(2-chloro-4-fluorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126269893 |
| Molecular Formula | C30H22Cl2FN3O5S |
| Molecular Weight | 626.49 g/mol |
| Exact Mass | 625.06 |
| IUPAC Name | ethyl 2-chloro-5-[[2-[(5Z)-5-[[1-[(2-chloro-4-fluorophenyl)methyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C\c3cn(Cc4ccc(F)cc4Cl)c4ccccc34)C2=O)ccc1Cl |
| InChI | InChI=1S/C30H22Cl2FN3O5S/c1-2-41-29(39)22-13-20(9-10-23(22)31)34-27(37)16-36-28(38)26(42-30(36)40)11-18-15-35(25-6-4-3-5-21(18)25)14-17-7-8-19(33)12-24(17)32/h3-13,15H,2,14,16H2,1H3,(H,34,37)/b26-11- |
| InChIKey | MHBPOZVWELEXEE-RAWMCFOBSA-N |
| XLogP | 6.99 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.49 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|