C28H20ClFN4O4S — CID 126278617
2-[3-[(Z)-[3-[2-(4-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 126278617) has the molecular formula C28H20ClFN4O4S and a molecular weight of 563.01 g/mol. Its IUPAC name is 2-[3-[(Z)-[3-[2-(4-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[3-[(Z)-[3-[2-(4-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126278617 |
| Molecular Formula | C28H20ClFN4O4S |
| Molecular Weight | 563.01 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | 2-[3-[(Z)-[3-[2-(4-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C\c2cn(CC(=O)Nc3ccc(F)cc3)c3ccccc23)C1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H20ClFN4O4S/c29-18-5-9-20(10-6-18)32-26(36)16-34-27(37)24(39-28(34)38)13-17-14-33(23-4-2-1-3-22(17)23)15-25(35)31-21-11-7-19(30)8-12-21/h1-14H,15-16H2,(H,31,35)(H,32,36)/b24-13- |
| InChIKey | GUPCQEJTXIUWCT-CFRMEGHHSA-N |
| XLogP | 5.75 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.01 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|