C28H27FN4O4S — CID 126278320
N-(4-fluorophenyl)-2-[3-[(Z)-[3-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide (PubChem CID 126278320) has the molecular formula C28H27FN4O4S and a molecular weight of 534.61 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[3-[(Z)-[3-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[3-[(Z)-[3-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 126278320 |
| Molecular Formula | C28H27FN4O4S |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | N-(4-fluorophenyl)-2-[3-[(Z)-[3-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide |
| SMILES | CC1CCN(C(=O)CN2C(=O)S/C(=C\c3cn(CC(=O)Nc4ccc(F)cc4)c4ccccc34)C2=O)CC1 |
| InChI | InChI=1S/C28H27FN4O4S/c1-18-10-12-31(13-11-18)26(35)17-33-27(36)24(38-28(33)37)14-19-15-32(23-5-3-2-4-22(19)23)16-25(34)30-21-8-6-20(29)7-9-21/h2-9,14-15,18H,10-13,16-17H2,1H3,(H,30,34)/b24-14- |
| InChIKey | LZCGEWCCDAIONT-OYKKKHCWSA-N |
| XLogP | 4.71 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|