C25H22FN3O5S — CID 3291129
ethyl 2-[5-[[1-[2-(4-fluoroanilino)-2-oxoethyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 3291129) has the molecular formula C25H22FN3O5S and a molecular weight of 495.53 g/mol. Its IUPAC name is ethyl 2-[5-[[1-[2-(4-fluoroanilino)-2-oxoethyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | ethyl 2-[5-[[1-[2-(4-fluoroanilino)-2-oxoethyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 3291129 |
| Molecular Formula | C25H22FN3O5S |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | ethyl 2-[5-[[1-[2-(4-fluoroanilino)-2-oxoethyl]indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | CCOC(=O)C(C)N1C(=O)SC(=Cc2cn(CC(=O)Nc3ccc(F)cc3)c3ccccc23)C1=O |
| InChI | InChI=1S/C25H22FN3O5S/c1-3-34-24(32)15(2)29-23(31)21(35-25(29)33)12-16-13-28(20-7-5-4-6-19(16)20)14-22(30)27-18-10-8-17(26)9-11-18/h4-13,15H,3,14H2,1-2H3,(H,27,30) |
| InChIKey | AXQKXRRQUVKJKI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|