C28H27FN4O5S — CID 126147988
2-[(5Z)-5-[[7-ethyl-1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 126147988) has the molecular formula C28H27FN4O5S and a molecular weight of 550.61 g/mol. Its IUPAC name is 2-[(5Z)-5-[[7-ethyl-1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[[7-ethyl-1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126147988 |
| Molecular Formula | C28H27FN4O5S |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | 2-[(5Z)-5-[[7-ethyl-1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | CCc1cccc2c(/C=C3\SC(=O)N(CC(=O)Nc4ccc(F)cc4)C3=O)cn(CC(=O)N3CCOCC3)c12 |
| InChI | InChI=1S/C28H27FN4O5S/c1-2-18-4-3-5-22-19(15-32(26(18)22)17-25(35)31-10-12-38-13-11-31)14-23-27(36)33(28(37)39-23)16-24(34)30-21-8-6-20(29)7-9-21/h3-9,14-15H,2,10-13,16-17H2,1H3,(H,30,34)/b23-14- |
| InChIKey | IPNUEFPYOCARTF-UCQKPKSFSA-N |
| XLogP | 3.88 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|