C27H33N3O3S2 — CID 126136058
(5Z)-3-(2-cyclopentylethyl)-5-[[7-ethyl-1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126136058) has the molecular formula C27H33N3O3S2 and a molecular weight of 511.71 g/mol. Its IUPAC name is (5Z)-3-(2-cyclopentylethyl)-5-[[7-ethyl-1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(2-cyclopentylethyl)-5-[[7-ethyl-1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126136058 |
| Molecular Formula | C27H33N3O3S2 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | (5Z)-3-(2-cyclopentylethyl)-5-[[7-ethyl-1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCc1cccc2c(/C=C3\SC(=S)N(CCC4CCCC4)C3=O)cn(CC(=O)N3CCOCC3)c12 |
| InChI | InChI=1S/C27H33N3O3S2/c1-2-20-8-5-9-22-21(17-29(25(20)22)18-24(31)28-12-14-33-15-13-28)16-23-26(32)30(27(34)35-23)11-10-19-6-3-4-7-19/h5,8-9,16-17,19H,2-4,6-7,10-15,18H2,1H3/b23-16- |
| InChIKey | SJTCRQJDMYSJJW-KQWNVCNZSA-N |
| XLogP | 4.84 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|