C30H31N3O4S — CID 126155360
(5Z)-5-[[7-ethyl-1-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione (PubChem CID 126155360) has the molecular formula C30H31N3O4S and a molecular weight of 529.66 g/mol. Its IUPAC name is (5Z)-5-[[7-ethyl-1-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[7-ethyl-1-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126155360 |
| Molecular Formula | C30H31N3O4S |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | (5Z)-5-[[7-ethyl-1-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-3-phenacyl-1,3-thiazolidine-2,4-dione |
| SMILES | CCc1cccc2c(/C=C3\SC(=O)N(CC(=O)c4ccccc4)C3=O)cn(CC(=O)N3CCCC[C@H]3C)c12 |
| InChI | InChI=1S/C30H31N3O4S/c1-3-21-13-9-14-24-23(17-31(28(21)24)19-27(35)32-15-8-7-10-20(32)2)16-26-29(36)33(30(37)38-26)18-25(34)22-11-5-4-6-12-22/h4-6,9,11-14,16-17,20H,3,7-8,10,15,18-19H2,1-2H3/b26-16-/t20-/m1/s1 |
| InChIKey | WYEHBUAGUQTYFZ-WWAUWJAYSA-N |
| XLogP | 5.52 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|