C29H22Cl2N2O3S — CID 126139551
(5Z)-5-[[1-[(2-chlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-[2-(4-chlorophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126139551) has the molecular formula C29H22Cl2N2O3S and a molecular weight of 549.48 g/mol. Its IUPAC name is (5Z)-5-[[1-[(2-chlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-[2-(4-chlorophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-[(2-chlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-[2-(4-chlorophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126139551 |
| Molecular Formula | C29H22Cl2N2O3S |
| Molecular Weight | 549.48 g/mol |
| Exact Mass | 548.07 |
| IUPAC Name | (5Z)-5-[[1-[(2-chlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-[2-(4-chlorophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCc1cccc2c(/C=C3\SC(=O)N(CC(=O)c4ccc(Cl)cc4)C3=O)cn(Cc3ccccc3Cl)c12 |
| InChI | InChI=1S/C29H22Cl2N2O3S/c1-2-18-7-5-8-23-21(16-32(27(18)23)15-20-6-3-4-9-24(20)31)14-26-28(35)33(29(36)37-26)17-25(34)19-10-12-22(30)13-11-19/h3-14,16H,2,15,17H2,1H3/b26-14- |
| InChIKey | PNZNRNXBADRYOC-WGARJPEWSA-N |
| XLogP | 7.48 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.48 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|