C27H18ClN3O5S — CID 126279410
(5E)-5-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylidene]-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126279410) has the molecular formula C27H18ClN3O5S and a molecular weight of 531.98 g/mol. Its IUPAC name is (5E)-5-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylidene]-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylidene]-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126279410 |
| Molecular Formula | C27H18ClN3O5S |
| Molecular Weight | 531.98 g/mol |
| Exact Mass | 531.07 |
| IUPAC Name | (5E)-5-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylidene]-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C/c2cn(Cc3ccccc3Cl)c3ccccc23)C1=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H18ClN3O5S/c28-22-7-3-1-5-18(22)14-29-15-19(21-6-2-4-8-23(21)29)13-25-26(33)30(27(34)37-25)16-24(32)17-9-11-20(12-10-17)31(35)36/h1-13,15H,14,16H2/b25-13+ |
| InChIKey | JJVCNOWDUCJCTL-DHRITJCHSA-N |
| XLogP | 6.17 |
| TPSA | 102.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.98 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|