C28H19N3O3S — CID 126146384
4-[[3-[(Z)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile (PubChem CID 126146384) has the molecular formula C28H19N3O3S and a molecular weight of 477.55 g/mol. Its IUPAC name is 4-[[3-[(Z)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[3-[(Z)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126146384 |
| Molecular Formula | C28H19N3O3S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 4-[[3-[(Z)-(2,4-dioxo-3-phenacyl-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(Cn2cc(/C=C3\SC(=O)N(CC(=O)c4ccccc4)C3=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H19N3O3S/c29-15-19-10-12-20(13-11-19)16-30-17-22(23-8-4-5-9-24(23)30)14-26-27(33)31(28(34)35-26)18-25(32)21-6-2-1-3-7-21/h1-14,17H,16,18H2/b26-14- |
| InChIKey | CUCRLOCSXSJHAO-WGARJPEWSA-N |
| XLogP | 5.48 |
| TPSA | 83.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|