C22H18N2O4S — CID 4233302
3-[[3-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]benzoic acid (PubChem CID 4233302) has the molecular formula C22H18N2O4S and a molecular weight of 406.46 g/mol. Its IUPAC name is 3-[[3-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[3-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 4233302 |
| Molecular Formula | C22H18N2O4S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 3-[[3-[(3-ethyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]benzoic acid |
| SMILES | CCN1C(=O)SC(=Cc2cn(Cc3cccc(C(=O)O)c3)c3ccccc23)C1=O |
| InChI | InChI=1S/C22H18N2O4S/c1-2-24-20(25)19(29-22(24)28)11-16-13-23(18-9-4-3-8-17(16)18)12-14-6-5-7-15(10-14)21(26)27/h3-11,13H,2,12H2,1H3,(H,26,27) |
| InChIKey | JURSWXRFPZGLQT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|