C34H27N3O4S — CID 21170680
3-[[3-[(E)-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]benzoic acid (PubChem CID 21170680) has the molecular formula C34H27N3O4S and a molecular weight of 573.67 g/mol. Its IUPAC name is 3-[[3-[(E)-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[3-[(E)-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 21170680 |
| Molecular Formula | C34H27N3O4S |
| Molecular Weight | 573.67 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | 3-[[3-[(E)-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]benzoic acid |
| SMILES | COc1ccc(CN2C(=O)/C(=C\c3cn(Cc4cccc(C(=O)O)c4)c4ccccc34)S/C2=N\c2ccccc2)cc1 |
| InChI | InChI=1S/C34H27N3O4S/c1-41-28-16-14-23(15-17-28)21-37-32(38)31(42-34(37)35-27-10-3-2-4-11-27)19-26-22-36(30-13-6-5-12-29(26)30)20-24-8-7-9-25(18-24)33(39)40/h2-19,22H,20-21H2,1H3,(H,39,40)/b31-19+,35-34- |
| InChIKey | KDPXCOIFLBNQNS-RACKAPSESA-N |
| XLogP | 7.20 |
| TPSA | 84.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.67 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|