C30H29N3O2S — CID 3663264
3-(2-ethoxyethyl)-5-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 3663264) has the molecular formula C30H29N3O2S and a molecular weight of 495.65 g/mol. Its IUPAC name is 3-(2-ethoxyethyl)-5-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | 3-(2-ethoxyethyl)-5-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3663264 |
| Molecular Formula | C30H29N3O2S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 3-(2-ethoxyethyl)-5-[[1-[(3-methylphenyl)methyl]indol-3-yl]methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CCOCCN1C(=O)C(=Cc2cn(Cc3cccc(C)c3)c3ccccc23)S/C1=N/c1ccccc1 |
| InChI | InChI=1S/C30H29N3O2S/c1-3-35-17-16-33-29(34)28(36-30(33)31-25-12-5-4-6-13-25)19-24-21-32(27-15-8-7-14-26(24)27)20-23-11-9-10-22(2)18-23/h4-15,18-19,21H,3,16-17,20H2,1-2H3/b28-19?,31-30+ |
| InChIKey | MSWGRVBOWAFJQD-HKCNYBAUSA-N |
| XLogP | 6.64 |
| TPSA | 46.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|