C26H21N3OS — CID 137071853
(5Z)-5-[(1-benzylindol-3-yl)methylidene]-2-(3-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137071853) has the molecular formula C26H21N3OS and a molecular weight of 423.54 g/mol. Its IUPAC name is (5Z)-5-[(1-benzylindol-3-yl)methylidene]-2-(3-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(1-benzylindol-3-yl)methylidene]-2-(3-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137071853 |
| Molecular Formula | C26H21N3OS |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | (5Z)-5-[(1-benzylindol-3-yl)methylidene]-2-(3-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1cccc(/N=C2\NC(=O)/C(=C/c3cn(Cc4ccccc4)c4ccccc34)S2)c1 |
| InChI | InChI=1S/C26H21N3OS/c1-18-8-7-11-21(14-18)27-26-28-25(30)24(31-26)15-20-17-29(16-19-9-3-2-4-10-19)23-13-6-5-12-22(20)23/h2-15,17H,16H2,1H3,(H,27,28,30)/b24-15- |
| InChIKey | YKCRRFPGQRGOHI-IWIPYMOSSA-N |
| XLogP | 5.89 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|