C25H17ClFN3OS — CID 137071677
(5Z)-5-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137071677) has the molecular formula C25H17ClFN3OS and a molecular weight of 461.95 g/mol. Its IUPAC name is (5Z)-5-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137071677 |
| Molecular Formula | C25H17ClFN3OS |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | (5Z)-5-[[1-[(4-chlorophenyl)methyl]indol-3-yl]methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2ccc(F)cc2)S/C1=C\c1cn(Cc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C25H17ClFN3OS/c26-18-7-5-16(6-8-18)14-30-15-17(21-3-1-2-4-22(21)30)13-23-24(31)29-25(32-23)28-20-11-9-19(27)10-12-20/h1-13,15H,14H2,(H,28,29,31)/b23-13- |
| InChIKey | FPYQDGNGNVKYSJ-QRVIBDJDSA-N |
| XLogP | 6.37 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|