C26H17FN4OS — CID 137034515
2-[[3-[(E)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]benzonitrile (PubChem CID 137034515) has the molecular formula C26H17FN4OS and a molecular weight of 452.51 g/mol. Its IUPAC name is 2-[[3-[(E)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[3-[(E)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 137034515 |
| Molecular Formula | C26H17FN4OS |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 2-[[3-[(E)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1Cn1cc(/C=C2/S/C(=N\c3ccc(F)cc3)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C26H17FN4OS/c27-20-9-11-21(12-10-20)29-26-30-25(32)24(33-26)13-19-16-31(23-8-4-3-7-22(19)23)15-18-6-2-1-5-17(18)14-28/h1-13,16H,15H2,(H,29,30,32)/b24-13+ |
| InChIKey | OWAPBRPMWXLXSV-ZMOGYAJESA-N |
| XLogP | 5.59 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|