C27H20N4O2S — CID 135441084
2-[[3-[(Z)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]benzonitrile (PubChem CID 135441084) has the molecular formula C27H20N4O2S and a molecular weight of 464.55 g/mol. Its IUPAC name is 2-[[3-[(Z)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[3-[(Z)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 135441084 |
| Molecular Formula | C27H20N4O2S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 2-[[3-[(Z)-[2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]benzonitrile |
| SMILES | COc1ccc(/N=C2\NC(=O)/C(=C/c3cn(Cc4ccccc4C#N)c4ccccc34)S2)cc1 |
| InChI | InChI=1S/C27H20N4O2S/c1-33-22-12-10-21(11-13-22)29-27-30-26(32)25(34-27)14-20-17-31(24-9-5-4-8-23(20)24)16-19-7-3-2-6-18(19)15-28/h2-14,17H,16H2,1H3,(H,29,30,32)/b25-14- |
| InChIKey | KZLJNHDRFKEJMT-QFEZKATASA-N |
| XLogP | 5.46 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|