C27H23N3OS — CID 137072050
(5Z)-5-[(1-benzylindol-3-yl)methylidene]-2-(3,4-dimethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137072050) has the molecular formula C27H23N3OS and a molecular weight of 437.57 g/mol. Its IUPAC name is (5Z)-5-[(1-benzylindol-3-yl)methylidene]-2-(3,4-dimethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(1-benzylindol-3-yl)methylidene]-2-(3,4-dimethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137072050 |
| Molecular Formula | C27H23N3OS |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | (5Z)-5-[(1-benzylindol-3-yl)methylidene]-2-(3,4-dimethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2\NC(=O)/C(=C/c3cn(Cc4ccccc4)c4ccccc34)S2)cc1C |
| InChI | InChI=1S/C27H23N3OS/c1-18-12-13-22(14-19(18)2)28-27-29-26(31)25(32-27)15-21-17-30(16-20-8-4-3-5-9-20)24-11-7-6-10-23(21)24/h3-15,17H,16H2,1-2H3,(H,28,29,31)/b25-15- |
| InChIKey | ZQDHKIZHMPOARN-MYYYXRDXSA-N |
| XLogP | 6.20 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|