C26H18Cl3N3OS — CID 137118850
(5Z)-2-(4-chloro-2-methylphenyl)imino-5-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137118850) has the molecular formula C26H18Cl3N3OS and a molecular weight of 526.88 g/mol. Its IUPAC name is (5Z)-2-(4-chloro-2-methylphenyl)imino-5-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-chloro-2-methylphenyl)imino-5-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137118850 |
| Molecular Formula | C26H18Cl3N3OS |
| Molecular Weight | 526.88 g/mol |
| Exact Mass | 525.02 |
| IUPAC Name | (5Z)-2-(4-chloro-2-methylphenyl)imino-5-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(Cl)ccc1/N=C1\NC(=O)/C(=C/c2cn(Cc3ccc(Cl)c(Cl)c3)c3ccccc23)S1 |
| InChI | InChI=1S/C26H18Cl3N3OS/c1-15-10-18(27)7-9-22(15)30-26-31-25(33)24(34-26)12-17-14-32(23-5-3-2-4-19(17)23)13-16-6-8-20(28)21(29)11-16/h2-12,14H,13H2,1H3,(H,30,31,33)/b24-12- |
| InChIKey | AEJNVHXNGGCBDS-MSXFZWOLSA-N |
| XLogP | 7.85 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.88 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|