C27H19Cl2N3O3S — CID 137071864
methyl 4-[[(5Z)-5-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 137071864) has the molecular formula C27H19Cl2N3O3S and a molecular weight of 536.44 g/mol. Its IUPAC name is methyl 4-[[(5Z)-5-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | methyl 4-[[(5Z)-5-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 137071864 |
| Molecular Formula | C27H19Cl2N3O3S |
| Molecular Weight | 536.44 g/mol |
| Exact Mass | 535.05 |
| IUPAC Name | methyl 4-[[(5Z)-5-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | COC(=O)c1ccc(/N=C2\NC(=O)/C(=C/c3cn(Cc4ccc(Cl)c(Cl)c4)c4ccccc34)S2)cc1 |
| InChI | InChI=1S/C27H19Cl2N3O3S/c1-35-26(34)17-7-9-19(10-8-17)30-27-31-25(33)24(36-27)13-18-15-32(23-5-3-2-4-20(18)23)14-16-6-11-21(28)22(29)12-16/h2-13,15H,14H2,1H3,(H,30,31,33)/b24-13- |
| InChIKey | XHVZFDYWOFFPPZ-CFRMEGHHSA-N |
| XLogP | 6.67 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.44 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|