C25H17Cl2N3O4S — CID 137156049
methyl 5-[[3-[(Z)-[2-(3,4-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]furan-2-carboxylate (PubChem CID 137156049) has the molecular formula C25H17Cl2N3O4S and a molecular weight of 526.40 g/mol. Its IUPAC name is methyl 5-[[3-[(Z)-[2-(3,4-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[3-[(Z)-[2-(3,4-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 137156049 |
| Molecular Formula | C25H17Cl2N3O4S |
| Molecular Weight | 526.40 g/mol |
| Exact Mass | 525.03 |
| IUPAC Name | methyl 5-[[3-[(Z)-[2-(3,4-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(Cn2cc(/C=C3\S/C(=N/c4ccc(Cl)c(Cl)c4)NC3=O)c3ccccc32)o1 |
| InChI | InChI=1S/C25H17Cl2N3O4S/c1-33-24(32)21-9-7-16(34-21)13-30-12-14(17-4-2-3-5-20(17)30)10-22-23(31)29-25(35-22)28-15-6-8-18(26)19(27)11-15/h2-12H,13H2,1H3,(H,28,29,31)/b22-10- |
| InChIKey | QHZKEXLPNDZRCC-YVNNLAQVSA-N |
| XLogP | 6.27 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.40 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|