C26H19BrClN3O2S — CID 137162296
(5Z)-5-[[1-[(4-bromophenyl)methyl]indol-3-yl]methylidene]-2-(5-chloro-2-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137162296) has the molecular formula C26H19BrClN3O2S and a molecular weight of 552.88 g/mol. Its IUPAC name is (5Z)-5-[[1-[(4-bromophenyl)methyl]indol-3-yl]methylidene]-2-(5-chloro-2-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[1-[(4-bromophenyl)methyl]indol-3-yl]methylidene]-2-(5-chloro-2-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137162296 |
| Molecular Formula | C26H19BrClN3O2S |
| Molecular Weight | 552.88 g/mol |
| Exact Mass | 551.01 |
| IUPAC Name | (5Z)-5-[[1-[(4-bromophenyl)methyl]indol-3-yl]methylidene]-2-(5-chloro-2-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(Cl)cc1/N=C1\NC(=O)/C(=C/c2cn(Cc3ccc(Br)cc3)c3ccccc23)S1 |
| InChI | InChI=1S/C26H19BrClN3O2S/c1-33-23-11-10-19(28)13-21(23)29-26-30-25(32)24(34-26)12-17-15-31(22-5-3-2-4-20(17)22)14-16-6-8-18(27)9-7-16/h2-13,15H,14H2,1H3,(H,29,30,32)/b24-12- |
| InChIKey | POPDTDRHIOGEQV-MSXFZWOLSA-N |
| XLogP | 7.01 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.88 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|