C27H22ClN3O2S — CID 137162517
(5Z)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-2-(5-chloro-2-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137162517) has the molecular formula C27H22ClN3O2S and a molecular weight of 488.01 g/mol. Its IUPAC name is (5Z)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-2-(5-chloro-2-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-2-(5-chloro-2-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137162517 |
| Molecular Formula | C27H22ClN3O2S |
| Molecular Weight | 488.01 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | (5Z)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-2-(5-chloro-2-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(Cl)cc1/N=C1\NC(=O)/C(=C/c2c(C)n(Cc3ccccc3)c3ccccc23)S1 |
| InChI | InChI=1S/C27H22ClN3O2S/c1-17-21(20-10-6-7-11-23(20)31(17)16-18-8-4-3-5-9-18)15-25-26(32)30-27(34-25)29-22-14-19(28)12-13-24(22)33-2/h3-15H,16H2,1-2H3,(H,29,30,32)/b25-15- |
| InChIKey | QINLGBIKNMNYGY-MYYYXRDXSA-N |
| XLogP | 6.55 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.01 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|