C27H22ClN3OS — CID 137136548
(5E)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-2-(3-chloro-2-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137136548) has the molecular formula C27H22ClN3OS and a molecular weight of 472.01 g/mol. Its IUPAC name is (5E)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-2-(3-chloro-2-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-2-(3-chloro-2-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137136548 |
| Molecular Formula | C27H22ClN3OS |
| Molecular Weight | 472.01 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | (5E)-5-[(1-benzyl-2-methylindol-3-yl)methylidene]-2-(3-chloro-2-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1c(Cl)cccc1/N=C1/NC(=O)/C(=C\c2c(C)n(Cc3ccccc3)c3ccccc23)S1 |
| InChI | InChI=1S/C27H22ClN3OS/c1-17-22(28)12-8-13-23(17)29-27-30-26(32)25(33-27)15-21-18(2)31(16-19-9-4-3-5-10-19)24-14-7-6-11-20(21)24/h3-15H,16H2,1-2H3,(H,29,30,32)/b25-15+ |
| InChIKey | XGNHSIZRJRGHJR-MFKUBSTISA-N |
| XLogP | 6.85 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.01 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|