C20H16ClN3OS — CID 135514974
2-(2-chlorophenyl)imino-5-[(1,2-dimethylindol-3-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135514974) has the molecular formula C20H16ClN3OS and a molecular weight of 381.89 g/mol. Its IUPAC name is 2-(2-chlorophenyl)imino-5-[(1,2-dimethylindol-3-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-(2-chlorophenyl)imino-5-[(1,2-dimethylindol-3-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135514974 |
| Molecular Formula | C20H16ClN3OS |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 2-(2-chlorophenyl)imino-5-[(1,2-dimethylindol-3-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1c(C=C2S/C(=N/c3ccccc3Cl)NC2=O)c2ccccc2n1C |
| InChI | InChI=1S/C20H16ClN3OS/c1-12-14(13-7-3-6-10-17(13)24(12)2)11-18-19(25)23-20(26-18)22-16-9-5-4-8-15(16)21/h3-11H,1-2H3,(H,22,23,25) |
| InChIKey | MVCHPSJUWMUCML-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|