C27H21Cl2N3O2S — CID 137162228
(5Z)-2-(5-chloro-2-methoxyphenyl)imino-5-[[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137162228) has the molecular formula C27H21Cl2N3O2S and a molecular weight of 522.46 g/mol. Its IUPAC name is (5Z)-2-(5-chloro-2-methoxyphenyl)imino-5-[[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(5-chloro-2-methoxyphenyl)imino-5-[[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137162228 |
| Molecular Formula | C27H21Cl2N3O2S |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | (5Z)-2-(5-chloro-2-methoxyphenyl)imino-5-[[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(Cl)cc1/N=C1\NC(=O)/C(=C/c2c(C)n(Cc3ccc(Cl)cc3)c3ccccc23)S1 |
| InChI | InChI=1S/C27H21Cl2N3O2S/c1-16-21(20-5-3-4-6-23(20)32(16)15-17-7-9-18(28)10-8-17)14-25-26(33)31-27(35-25)30-22-13-19(29)11-12-24(22)34-2/h3-14H,15H2,1-2H3,(H,30,31,33)/b25-14- |
| InChIKey | DUAXQUVOFIDSHQ-QFEZKATASA-N |
| XLogP | 7.21 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|