C25H17Cl2N3OS — CID 135512076
(5E)-5-[(1-benzylindol-3-yl)methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135512076) has the molecular formula C25H17Cl2N3OS and a molecular weight of 478.40 g/mol. Its IUPAC name is (5E)-5-[(1-benzylindol-3-yl)methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(1-benzylindol-3-yl)methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135512076 |
| Molecular Formula | C25H17Cl2N3OS |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | (5E)-5-[(1-benzylindol-3-yl)methylidene]-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2cccc(Cl)c2Cl)S/C1=C/c1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C25H17Cl2N3OS/c26-19-10-6-11-20(23(19)27)28-25-29-24(31)22(32-25)13-17-15-30(14-16-7-2-1-3-8-16)21-12-5-4-9-18(17)21/h1-13,15H,14H2,(H,28,29,31)/b22-13+ |
| InChIKey | HPWYIMKBYVMYBT-LPYMAVHISA-N |
| XLogP | 6.89 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|