C20H14Cl2N4O2S — CID 137137149
2-[3-[(Z)-[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide (PubChem CID 137137149) has the molecular formula C20H14Cl2N4O2S and a molecular weight of 445.33 g/mol. Its IUPAC name is 2-[3-[(Z)-[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide.
| Compound Name | 2-[3-[(Z)-[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 137137149 |
| Molecular Formula | C20H14Cl2N4O2S |
| Molecular Weight | 445.33 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | 2-[3-[(Z)-[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide |
| SMILES | NC(=O)Cn1cc(/C=C2\S/C(=N/c3cccc(Cl)c3Cl)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C20H14Cl2N4O2S/c21-13-5-3-6-14(18(13)22)24-20-25-19(28)16(29-20)8-11-9-26(10-17(23)27)15-7-2-1-4-12(11)15/h1-9H,10H2,(H2,23,27)(H,24,25,28)/b16-8- |
| InChIKey | WEHBVSQDTZVTRL-PXNMLYILSA-N |
| XLogP | 4.32 |
| TPSA | 89.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|