C22H17N3O5S — CID 140534383
2-[4-[[5-[[1-(carboxymethyl)indol-3-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid (PubChem CID 140534383) has the molecular formula C22H17N3O5S and a molecular weight of 435.46 g/mol. Its IUPAC name is 2-[4-[[5-[[1-(carboxymethyl)indol-3-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[5-[[1-(carboxymethyl)indol-3-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 140534383 |
| Molecular Formula | C22H17N3O5S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 2-[4-[[5-[[1-(carboxymethyl)indol-3-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(/N=C2\NC(=O)C(=Cc3cn(CC(=O)O)c4ccccc34)S2)cc1 |
| InChI | InChI=1S/C22H17N3O5S/c26-19(27)9-13-5-7-15(8-6-13)23-22-24-21(30)18(31-22)10-14-11-25(12-20(28)29)17-4-2-1-3-16(14)17/h1-8,10-11H,9,12H2,(H,26,27)(H,28,29)(H,23,24,30) |
| InChIKey | QUEGEHMAAJJUMG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 120.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|