C21H18N4O2S — CID 135423230
2-[3-[[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide (PubChem CID 135423230) has the molecular formula C21H18N4O2S and a molecular weight of 390.47 g/mol. Its IUPAC name is 2-[3-[[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide.
| Compound Name | 2-[3-[[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 135423230 |
| Molecular Formula | C21H18N4O2S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-[3-[[2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide |
| SMILES | Cc1ccc(/N=C2\NC(=O)C(=Cc3cn(CC(N)=O)c4ccccc34)S2)cc1 |
| InChI | InChI=1S/C21H18N4O2S/c1-13-6-8-15(9-7-13)23-21-24-20(27)18(28-21)10-14-11-25(12-19(22)26)17-5-3-2-4-16(14)17/h2-11H,12H2,1H3,(H2,22,26)(H,23,24,27) |
| InChIKey | RIDHYNYMSUVKTD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 89.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|