C26H18F2N4O2S — CID 135641320
N-(4-fluorophenyl)-2-[3-[(E)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide (PubChem CID 135641320) has the molecular formula C26H18F2N4O2S and a molecular weight of 488.52 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[3-[(E)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[3-[(E)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 135641320 |
| Molecular Formula | C26H18F2N4O2S |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | N-(4-fluorophenyl)-2-[3-[(E)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide |
| SMILES | O=C(Cn1cc(/C=C2/S/C(=N\c3ccc(F)cc3)NC2=O)c2ccccc21)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H18F2N4O2S/c27-17-5-9-19(10-6-17)29-24(33)15-32-14-16(21-3-1-2-4-22(21)32)13-23-25(34)31-26(35-23)30-20-11-7-18(28)8-12-20/h1-14H,15H2,(H,29,33)(H,30,31,34)/b23-13+ |
| InChIKey | QLGAKMWZFGTPLF-YDZHTSKRSA-N |
| XLogP | 5.45 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|