C28H23FN4O3S — CID 137139609
2-[3-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 137139609) has the molecular formula C28H23FN4O3S and a molecular weight of 514.58 g/mol. Its IUPAC name is 2-[3-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[3-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 137139609 |
| Molecular Formula | C28H23FN4O3S |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 2-[3-[(E)-[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | CCOc1ccc(/N=C2/NC(=O)/C(=C\c3cn(CC(=O)Nc4ccc(F)cc4)c4ccccc34)S2)cc1 |
| InChI | InChI=1S/C28H23FN4O3S/c1-2-36-22-13-11-21(12-14-22)31-28-32-27(35)25(37-28)15-18-16-33(24-6-4-3-5-23(18)24)17-26(34)30-20-9-7-19(29)8-10-20/h3-16H,2,17H2,1H3,(H,30,34)(H,31,32,35)/b25-15+ |
| InChIKey | RNZSRQGSRSGWHG-MFKUBSTISA-N |
| XLogP | 5.71 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|