C21H17ClN4O2S — CID 137108283
2-[3-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide (PubChem CID 137108283) has the molecular formula C21H17ClN4O2S and a molecular weight of 424.91 g/mol. Its IUPAC name is 2-[3-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide.
| Compound Name | 2-[3-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 137108283 |
| Molecular Formula | C21H17ClN4O2S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 2-[3-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide |
| SMILES | Cc1c(Cl)cccc1/N=C1\NC(=O)/C(=C/c2cn(CC(N)=O)c3ccccc23)S1 |
| InChI | InChI=1S/C21H17ClN4O2S/c1-12-15(22)6-4-7-16(12)24-21-25-20(28)18(29-21)9-13-10-26(11-19(23)27)17-8-3-2-5-14(13)17/h2-10H,11H2,1H3,(H2,23,27)(H,24,25,28)/b18-9- |
| InChIKey | HGISZGQGAOQOLX-NVMNQCDNSA-N |
| XLogP | 3.98 |
| TPSA | 89.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|