C29H24N4O2S — CID 135521035
2-[[3-[[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]methyl]benzonitrile (PubChem CID 135521035) has the molecular formula C29H24N4O2S and a molecular weight of 492.60 g/mol. Its IUPAC name is 2-[[3-[[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[3-[[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 135521035 |
| Molecular Formula | C29H24N4O2S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 2-[[3-[[2-(4-ethoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methylindol-1-yl]methyl]benzonitrile |
| SMILES | CCOc1ccc(/N=C2\NC(=O)C(=Cc3c(C)n(Cc4ccccc4C#N)c4ccccc34)S2)cc1 |
| InChI | InChI=1S/C29H24N4O2S/c1-3-35-23-14-12-22(13-15-23)31-29-32-28(34)27(36-29)16-25-19(2)33(26-11-7-6-10-24(25)26)18-21-9-5-4-8-20(21)17-30/h4-16H,3,18H2,1-2H3,(H,31,32,34) |
| InChIKey | JVWYYHXDAJCGPH-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|