C22H17N3OS2 — CID 126355826
2-[[2-methyl-3-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile (PubChem CID 126355826) has the molecular formula C22H17N3OS2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 2-[[2-methyl-3-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[2-methyl-3-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126355826 |
| Molecular Formula | C22H17N3OS2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 2-[[2-methyl-3-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]benzonitrile |
| SMILES | Cc1c(/C=C2/SC(=S)N(C)C2=O)c2ccccc2n1Cc1ccccc1C#N |
| InChI | InChI=1S/C22H17N3OS2/c1-14-18(11-20-21(26)24(2)22(27)28-20)17-9-5-6-10-19(17)25(14)13-16-8-4-3-7-15(16)12-23/h3-11H,13H2,1-2H3/b20-11+ |
| InChIKey | WYPRVHWQSATFKA-RGVLZGJSSA-N |
| XLogP | 4.70 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|