C28H21FN4O2 — CID 126077852
2-[[3-[(E)-[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methylindol-1-yl]methyl]benzonitrile (PubChem CID 126077852) has the molecular formula C28H21FN4O2 and a molecular weight of 464.50 g/mol. Its IUPAC name is 2-[[3-[(E)-[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methylindol-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[3-[(E)-[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methylindol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126077852 |
| Molecular Formula | C28H21FN4O2 |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 2-[[3-[(E)-[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methylindol-1-yl]methyl]benzonitrile |
| SMILES | Cc1c(/C=C2/NC(=O)N(Cc3ccccc3F)C2=O)c2ccccc2n1Cc1ccccc1C#N |
| InChI | InChI=1S/C28H21FN4O2/c1-18-23(14-25-27(34)33(28(35)31-25)17-21-10-4-6-12-24(21)29)22-11-5-7-13-26(22)32(18)16-20-9-3-2-8-19(20)15-30/h2-14H,16-17H2,1H3,(H,31,35)/b25-14+ |
| InChIKey | OVRBHALNPGUPQT-AFUMVMLFSA-N |
| XLogP | 5.10 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_F(8)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|