C28H24ClN3O2 — CID 126234525
(5E)-5-[[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 126234525) has the molecular formula C28H24ClN3O2 and a molecular weight of 469.97 g/mol. Its IUPAC name is (5E)-5-[[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126234525 |
| Molecular Formula | C28H24ClN3O2 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | (5E)-5-[[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(CN2C(=O)N/C(=C/c3c(C)n(Cc4ccc(Cl)cc4)c4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C28H24ClN3O2/c1-18-7-9-20(10-8-18)17-32-27(33)25(30-28(32)34)15-24-19(2)31(26-6-4-3-5-23(24)26)16-21-11-13-22(29)14-12-21/h3-15H,16-17H2,1-2H3,(H,30,34)/b25-15+ |
| InChIKey | XJQOYVXXUHKWCO-MFKUBSTISA-N |
| XLogP | 6.05 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_F(8)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|