C24H19ClN2O2S — CID 126073621
(5Z)-5-[[4-(4-chlorophenyl)sulfanylphenyl]methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 126073621) has the molecular formula C24H19ClN2O2S and a molecular weight of 434.95 g/mol. Its IUPAC name is (5Z)-5-[[4-(4-chlorophenyl)sulfanylphenyl]methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-(4-chlorophenyl)sulfanylphenyl]methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126073621 |
| Molecular Formula | C24H19ClN2O2S |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | (5Z)-5-[[4-(4-chlorophenyl)sulfanylphenyl]methylidene]-3-[(4-methylphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(CN2C(=O)N/C(=C\c3ccc(Sc4ccc(Cl)cc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H19ClN2O2S/c1-16-2-4-18(5-3-16)15-27-23(28)22(26-24(27)29)14-17-6-10-20(11-7-17)30-21-12-8-19(25)9-13-21/h2-14H,15H2,1H3,(H,26,29)/b22-14- |
| InChIKey | PTGPFPDQPAZING-HMAPJEAMSA-N |
| XLogP | 5.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|