C24H20N2O2S — CID 1021327
3-[(4-methylphenyl)methyl]-5-[(2-phenylsulfanylphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 1021327) has the molecular formula C24H20N2O2S and a molecular weight of 400.50 g/mol. Its IUPAC name is 3-[(4-methylphenyl)methyl]-5-[(2-phenylsulfanylphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | 3-[(4-methylphenyl)methyl]-5-[(2-phenylsulfanylphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 1021327 |
| Molecular Formula | C24H20N2O2S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 3-[(4-methylphenyl)methyl]-5-[(2-phenylsulfanylphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(CN2C(=O)NC(=Cc3ccccc3Sc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C24H20N2O2S/c1-17-11-13-18(14-12-17)16-26-23(27)21(25-24(26)28)15-19-7-5-6-10-22(19)29-20-8-3-2-4-9-20/h2-15H,16H2,1H3,(H,25,28) |
| InChIKey | FKQZHHVBEBEYBB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|