C22H18N4O2 — CID 126240677
2-[3-[(E)-[1-[(4-methylphenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]indol-1-yl]acetonitrile (PubChem CID 126240677) has the molecular formula C22H18N4O2 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-[3-[(E)-[1-[(4-methylphenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]indol-1-yl]acetonitrile.
| Compound Name | 2-[3-[(E)-[1-[(4-methylphenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]indol-1-yl]acetonitrile |
|---|---|
| PubChem CID | 126240677 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-[3-[(E)-[1-[(4-methylphenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]indol-1-yl]acetonitrile |
| SMILES | Cc1ccc(CN2C(=O)N/C(=C/c3cn(CC#N)c4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C22H18N4O2/c1-15-6-8-16(9-7-15)13-26-21(27)19(24-22(26)28)12-17-14-25(11-10-23)20-5-3-2-4-18(17)20/h2-9,12,14H,11,13H2,1H3,(H,24,28)/b19-12+ |
| InChIKey | KXPQISKYZAERKX-XDHOZWIPSA-N |
| XLogP | 3.57 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|