C30H23N3O2 — CID 126244564
(5E)-3-benzyl-5-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]imidazolidine-2,4-dione (PubChem CID 126244564) has the molecular formula C30H23N3O2 and a molecular weight of 457.53 g/mol. Its IUPAC name is (5E)-3-benzyl-5-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-benzyl-5-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126244564 |
| Molecular Formula | C30H23N3O2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | (5E)-3-benzyl-5-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2cn(Cc3cccc4ccccc34)c3ccccc23)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C30H23N3O2/c34-29-27(31-30(35)33(29)18-21-9-2-1-3-10-21)17-24-20-32(28-16-7-6-15-26(24)28)19-23-13-8-12-22-11-4-5-14-25(22)23/h1-17,20H,18-19H2,(H,31,35)/b27-17+ |
| InChIKey | NIYKKBSDOSVMOO-WPWMEQJKSA-N |
| XLogP | 5.94 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|