C26H19FN4O4 — CID 126025581
(5E)-3-[(4-fluorophenyl)methyl]-5-[[1-[(3-nitrophenyl)methyl]indol-3-yl]methylidene]imidazolidine-2,4-dione (PubChem CID 126025581) has the molecular formula C26H19FN4O4 and a molecular weight of 470.46 g/mol. Its IUPAC name is (5E)-3-[(4-fluorophenyl)methyl]-5-[[1-[(3-nitrophenyl)methyl]indol-3-yl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-[(4-fluorophenyl)methyl]-5-[[1-[(3-nitrophenyl)methyl]indol-3-yl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126025581 |
| Molecular Formula | C26H19FN4O4 |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | (5E)-3-[(4-fluorophenyl)methyl]-5-[[1-[(3-nitrophenyl)methyl]indol-3-yl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2cn(Cc3cccc([N+](=O)[O-])c3)c3ccccc23)C(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C26H19FN4O4/c27-20-10-8-17(9-11-20)15-30-25(32)23(28-26(30)33)13-19-16-29(24-7-2-1-6-22(19)24)14-18-4-3-5-21(12-18)31(34)35/h1-13,16H,14-15H2,(H,28,33)/b23-13+ |
| InChIKey | ZWWGAHRDPWOBOS-YDZHTSKRSA-N |
| XLogP | 4.83 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|